C29H48N2O4 — CID 57367504
[(8S,9S,10R,13S,14S,17R)-16-hydroxy-10,13-dimethyl-17-[(2R)-6-methyl-7-(2-oxohydrazinyl)heptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 57367504) has the molecular formula C29H48N2O4 and a molecular weight of 488.71 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-16-hydroxy-10,13-dimethyl-17-[(2R)-6-methyl-7-(2-oxohydrazinyl)heptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-16-hydroxy-10,13-dimethyl-17-[(2R)-6-methyl-7-(2-oxohydrazinyl)heptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 57367504 |
| Molecular Formula | C29H48N2O4 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.36 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-16-hydroxy-10,13-dimethyl-17-[(2R)-6-methyl-7-(2-oxohydrazinyl)heptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC(O)[C@H]([C@H](C)CCCC(C)CNN=O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H48N2O4/c1-18(17-30-31-34)7-6-8-19(2)27-26(33)16-25-23-10-9-21-15-22(35-20(3)32)11-13-28(21,4)24(23)12-14-29(25,27)5/h9,18-19,22-27,33H,6-8,10-17H2,1-5H3,(H,30,34)/t18?,19-,22?,23-,24+,25+,26?,27+,28+,29+/m1/s1 |
| InChIKey | OSIKZVHTUFDSHH-HVQYZJBQSA-N |
| XLogP | 6.18 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|