C27H46O12S3 — CID 22832402
[(6R)-6-[(2S,3S,10R,13R,17R)-10,13-dimethyl-2,3-disulfooxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl] hydrogen sulfate (PubChem CID 22832402) has the molecular formula C27H46O12S3 and a molecular weight of 658.85 g/mol. Its IUPAC name is [(6R)-6-[(2S,3S,10R,13R,17R)-10,13-dimethyl-2,3-disulfooxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl] hydrogen sulfate.
| Compound Name | [(6R)-6-[(2S,3S,10R,13R,17R)-10,13-dimethyl-2,3-disulfooxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl] hydrogen sulfate |
|---|---|
| PubChem CID | 22832402 |
| Molecular Formula | C27H46O12S3 |
| Molecular Weight | 658.85 g/mol |
| Exact Mass | 658.22 |
| IUPAC Name | [(6R)-6-[(2S,3S,10R,13R,17R)-10,13-dimethyl-2,3-disulfooxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl] hydrogen sulfate |
| SMILES | CC(CCC[C@@H](C)[C@H]1CCC2C3CC=C4C[C@H](OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)C[C@]4(C)C3CC[C@@]21C)COS(=O)(=O)O |
| InChI | InChI=1S/C27H46O12S3/c1-17(16-37-40(28,29)30)6-5-7-18(2)21-10-11-22-20-9-8-19-14-24(38-41(31,32)33)25(39-42(34,35)36)15-27(19,4)23(20)12-13-26(21,22)3/h8,17-18,20-25H,5-7,9-16H2,1-4H3,(H,28,29,30)(H,31,32,33)(H,34,35,36)/t17?,18-,20?,21-,22?,23?,24+,25+,26-,27+/m1/s1 |
| InChIKey | XEJJMDUMLSMFRE-BWTIOLSVSA-N |
| XLogP | 4.81 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.85 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|