C21H34O5 — CID 22832433
methyl (2S,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-5-hydroxy-3-(hydroxymethyl)oxolane-2-carboxylate (PubChem CID 22832433) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is methyl (2S,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-5-hydroxy-3-(hydroxymethyl)oxolane-2-carboxylate.
| Compound Name | methyl (2S,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-5-hydroxy-3-(hydroxymethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 22832433 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | methyl (2S,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-5-hydroxy-3-(hydroxymethyl)oxolane-2-carboxylate |
| SMILES | C=C1CCCC(C)(C)[C@@H]2CC[C@@](C)([C@@H]3C(O)O[C@H](C(=O)OC)[C@H]3CO)[C@H]12 |
| InChI | InChI=1S/C21H34O5/c1-12-7-6-9-20(2,3)14-8-10-21(4,15(12)14)16-13(11-22)17(19(24)25-5)26-18(16)23/h13-18,22-23H,1,6-11H2,2-5H3/t13-,14+,15+,16-,17-,18?,21+/m0/s1 |
| InChIKey | HPQVDDUSDREVAN-IPCRPTJGSA-N |
| XLogP | 2.90 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|