C28H42O2 — CID 22833141
(3aR,8S)-3-[(E,2R)-5,6-dimethylhept-3-en-2-yl]-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracene-5,8-diol (PubChem CID 22833141) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is (3aR,8S)-3-[(E,2R)-5,6-dimethylhept-3-en-2-yl]-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracene-5,8-diol.
| Compound Name | (3aR,8S)-3-[(E,2R)-5,6-dimethylhept-3-en-2-yl]-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracene-5,8-diol |
|---|---|
| PubChem CID | 22833141 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | (3aR,8S)-3-[(E,2R)-5,6-dimethylhept-3-en-2-yl]-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracene-5,8-diol |
| SMILES | Cc1c2c(cc3c1C(O)C[C@@]1(C)C3CCC1[C@H](C)/C=C/C(C)C(C)C)CC[C@H](O)C2 |
| InChI | InChI=1S/C28H42O2/c1-16(2)17(3)7-8-18(4)24-11-12-25-23-13-20-9-10-21(29)14-22(20)19(5)27(23)26(30)15-28(24,25)6/h7-8,13,16-18,21,24-26,29-30H,9-12,14-15H2,1-6H3/b8-7+/t17?,18-,21+,24?,25?,26?,28-/m1/s1 |
| InChIKey | PWOLTSTXQZMPQX-ISYXVISLSA-N |
| XLogP | 6.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|