C28H40O — CID 11303940
(3R,3aR,8S,11bR)-3-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a,6-dimethyl-1,2,3,7,8,9,10,11b-octahydrocyclopenta[a]anthracen-8-ol (PubChem CID 11303940) has the molecular formula C28H40O and a molecular weight of 392.63 g/mol. Its IUPAC name is (3R,3aR,8S,11bR)-3-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a,6-dimethyl-1,2,3,7,8,9,10,11b-octahydrocyclopenta[a]anthracen-8-ol.
| Compound Name | (3R,3aR,8S,11bR)-3-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a,6-dimethyl-1,2,3,7,8,9,10,11b-octahydrocyclopenta[a]anthracen-8-ol |
|---|---|
| PubChem CID | 11303940 |
| Molecular Formula | C28H40O |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | (3R,3aR,8S,11bR)-3-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a,6-dimethyl-1,2,3,7,8,9,10,11b-octahydrocyclopenta[a]anthracen-8-ol |
| SMILES | Cc1c2c(cc3c1C[C@@H](O)CC3)[C@@H]1CC[C@H]([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)C=C2 |
| InChI | InChI=1S/C28H40O/c1-17(2)18(3)7-8-19(4)26-11-12-27-25-15-21-9-10-22(29)16-24(21)20(5)23(25)13-14-28(26,27)6/h7-8,13-15,17-19,22,26-27,29H,9-12,16H2,1-6H3/b8-7+/t18-,19+,22-,26+,27-,28+/m0/s1 |
| InChIKey | GWOAMHMYCJRYMO-NIDOPEEVSA-N |
| XLogP | 6.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|