C18H21NO6 — CID 2283370
1,3-dimethoxy-2-[3-(4-methyl-2-nitrophenoxy)propoxy]benzene (PubChem CID 2283370) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is 1,3-dimethoxy-2-[3-(4-methyl-2-nitrophenoxy)propoxy]benzene.
| Compound Name | 1,3-dimethoxy-2-[3-(4-methyl-2-nitrophenoxy)propoxy]benzene |
|---|---|
| PubChem CID | 2283370 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1,3-dimethoxy-2-[3-(4-methyl-2-nitrophenoxy)propoxy]benzene |
| SMILES | COc1cccc(OC)c1OCCCOc1ccc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21NO6/c1-13-8-9-15(14(12-13)19(20)21)24-10-5-11-25-18-16(22-2)6-4-7-17(18)23-3/h4,6-9,12H,5,10-11H2,1-3H3 |
| InChIKey | SVZLQGAOTLEZNR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|