C32H32N4O4Zn — CID 22833754
zinc (Z)-[(7S,8S)-17-ethyl-12-formyl-8-(3-methoxy-3-oxopropyl)-3,7,13,18-tetramethyl-7,8-dihydroporphyrin-24-id-2-ylidene]methanolate (PubChem CID 22833754) has the molecular formula C32H32N4O4Zn and a molecular weight of 602.02 g/mol. Its IUPAC name is zinc (Z)-[(7S,8S)-17-ethyl-12-formyl-8-(3-methoxy-3-oxopropyl)-3,7,13,18-tetramethyl-7,8-dihydroporphyrin-24-id-2-ylidene]methanolate.
| Compound Name | zinc (Z)-[(7S,8S)-17-ethyl-12-formyl-8-(3-methoxy-3-oxopropyl)-3,7,13,18-tetramethyl-7,8-dihydroporphyrin-24-id-2-ylidene]methanolate |
|---|---|
| PubChem CID | 22833754 |
| Molecular Formula | C32H32N4O4Zn |
| Molecular Weight | 602.02 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | zinc (Z)-[(7S,8S)-17-ethyl-12-formyl-8-(3-methoxy-3-oxopropyl)-3,7,13,18-tetramethyl-7,8-dihydroporphyrin-24-id-2-ylidene]methanolate |
| SMILES | CCc1c(C)/c2[n-]/c1=C\C1=N/C(=C\C3=N/C(=C\C4=C(C)/C(=C/[O-])C(=N4)/C=2)[C@@H](C)[C@@H]3CCC(=O)OC)C(C=O)=C1C.[Zn+2] |
| InChI | InChI=1S/C32H34N4O4.Zn/c1-7-20-16(2)26-12-30-22(14-37)18(4)25(35-30)10-24-17(3)21(8-9-32(39)40-6)29(34-24)13-31-23(15-38)19(5)27(36-31)11-28(20)33-26;/h10-15,17,21H,7-9H2,1-6H3,(H2,33,34,35,36,37,38);/q;+2/p-2/t17-,21-;/m0./s1 |
| InChIKey | JXFYLEYBGOHWRL-PVMVIUQGSA-L |
| XLogP | 2.46 |
| TPSA | 117.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.02 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|