C120H124N16O12Zn2 — CID 22835007
CID 22835007 (PubChem CID 22835007) has the molecular formula C120H124N16O12Zn2 and a molecular weight of 2113.19 g/mol.
| Compound Name | CID 22835007 |
|---|---|
| PubChem CID | 22835007 |
| Molecular Formula | C120H124N16O12Zn2 |
| Molecular Weight | 2113.19 g/mol |
| Exact Mass | 2108.82 |
| IUPAC Name | — |
| SMILES | CCCCOc1cc2c(cc1OCCCC)-c1nc-2nc2[n-]c(nc3nc(nc4[n-]c(n1)c1cc(OCCCC)c(OCCCC)cc41)-c1cc(OCCCC)c(OCCCC)cc1-3)c1cc3c(cc21)C#CC#Cc1cc2c4nc5nc(nc6[n-]c(nc7nc(nc([n-]4)c2cc1C#CC#C3)-c1cc(OCCCC)c(OCCCC)cc1-7)c1cc(OCCCC)c(OCCCC)cc61)-c1cc(OCCCC)c(OCCCC)cc1-5.[Zn+2].[Zn+2] |
| InChI | InChI=1S/C120H124N16O12.2Zn/c1-13-25-45-137-93-61-81-85(65-97(93)141-49-29-17-5)113-127-109(81)123-105-77-57-73-41-37-38-43-75-59-79-80(60-76(75)44-40-39-42-74(73)58-78(77)106(121-105)124-110-82-62-94(138-46-26-14-2)98(142-50-30-18-6)66-86(82)114(128-110)132-118-90-70-102(146-54-34-22-10)101(145-53-33-21-9)69-89(90)117(131-113)135-118)108-122-107(79)125-111-83-63-95(139-47-27-15-3)99(143-51-31-19-7)67-87(83)115(129-111)133-119-91-71-103(147-55-35-23-11)104(148-56-36-24-12)72-92(91)120(136-119)134-116-88-68-100(144-52-32-20-8)96(140-48-28-16-4)64-84(88)112(126-108)130-116;;/h57-72H,13-36,45-56H2,1-12H3;;/q-4;2*+2 |
| InChIKey | RNMUBAZJMANJGT-UHFFFAOYSA-N |
| XLogP | 25.83 |
| TPSA | 321.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 150 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2113.19 |
| LogP ≤ 5 | 25.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|