C13H21NO5 — CID 22839940
(1-ethoxy-1-oxohexan-2-yl) (2S)-5-oxopyrrolidine-2-carboxylate (PubChem CID 22839940) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is (1-ethoxy-1-oxohexan-2-yl) (2S)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | (1-ethoxy-1-oxohexan-2-yl) (2S)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 22839940 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (1-ethoxy-1-oxohexan-2-yl) (2S)-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCCCC(OC(=O)[C@@H]1CCC(=O)N1)C(=O)OCC |
| InChI | InChI=1S/C13H21NO5/c1-3-5-6-10(13(17)18-4-2)19-12(16)9-7-8-11(15)14-9/h9-10H,3-8H2,1-2H3,(H,14,15)/t9-,10?/m0/s1 |
| InChIKey | FRBRJCLGUWJWKU-RGURZIINSA-N |
| XLogP | 0.93 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |