C24H26N2 — CID 22841438
3-[2-[4-[1-(3-aminophenyl)propan-2-ylidene]cyclohexa-2,5-dien-1-ylidene]propyl]aniline (PubChem CID 22841438) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 3-[2-[4-[1-(3-aminophenyl)propan-2-ylidene]cyclohexa-2,5-dien-1-ylidene]propyl]aniline.
| Compound Name | 3-[2-[4-[1-(3-aminophenyl)propan-2-ylidene]cyclohexa-2,5-dien-1-ylidene]propyl]aniline |
|---|---|
| PubChem CID | 22841438 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 3-[2-[4-[1-(3-aminophenyl)propan-2-ylidene]cyclohexa-2,5-dien-1-ylidene]propyl]aniline |
| SMILES | CC(Cc1cccc(N)c1)=c1ccc(=C(C)Cc2cccc(N)c2)cc1 |
| InChI | InChI=1S/C24H26N2/c1-17(13-19-5-3-7-23(25)15-19)21-9-11-22(12-10-21)18(2)14-20-6-4-8-24(26)16-20/h3-12,15-16H,13-14,25-26H2,1-2H3/b21-17-,22-18+ |
| InChIKey | AFTHWCMUWRHULU-QGFZOGOGSA-N |
| XLogP | 3.68 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|