(2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid

C12H20N2O4 — CID 22844372

IUPAC(2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid
SMILESCC(C)CC(C(=O)O)N1C(=O)CCCC(N)C1=O
InChIInChI=1S/C12H20N2O4/c1-7(2)6-9(12(17)18)14-10(15)5-3-4-8(13)11(14)16/h7-9H,3-6,13H2,1-2H3,(H,17,18)
InChIKeyTVHUWGZUAYCJHS-UHFFFAOYSA-N
MW256.30 g/mol
LogP0.35
Rot. Bonds4

About (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid

(2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid (PubChem CID 22844372) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid.

Molecular Properties

Compound Name(2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid
PubChem CID22844372
Molecular FormulaC12H20N2O4
Molecular Weight256.30 g/mol
Exact Mass256.14
IUPAC Name(2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid
SMILESCC(C)CC(C(=O)O)N1C(=O)CCCC(N)C1=O
InChIInChI=1S/C12H20N2O4/c1-7(2)6-9(12(17)18)14-10(15)5-3-4-8(13)11(14)16/h7-9H,3-6,13H2,1-2H3,(H,17,18)
InChIKeyTVHUWGZUAYCJHS-UHFFFAOYSA-N
XLogP0.35
TPSA100.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.30
LogP ≤ 50.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid?
The IUPAC name of (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid (CID 22844372) is (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid.
What is the SMILES notation for (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid?
The canonical SMILES for (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid is CC(C)CC(C(=O)O)N1C(=O)CCCC(N)C1=O.
What is the InChIKey of (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid?
The InChIKey is TVHUWGZUAYCJHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O4/c1-7(2)6-9(12(17)18)14-10(15)5-3-4-8(13)11(14)16/h7-9H,3-6,13H2,1-2H3,(H,17,18).
What are the key properties of (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid?
(2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid has a molecular weight of 256.30 g/mol, XLogP of 0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid is sourced from PubChem (CID 22844372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).