C12H20N2O4 — CID 22844372
(2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid (PubChem CID 22844372) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid.
| Compound Name | (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22844372 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (2S)-2-(3-amino-2,7-dioxoazepan-1-yl)-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N1C(=O)CCCC(N)C1=O |
| InChI | InChI=1S/C12H20N2O4/c1-7(2)6-9(12(17)18)14-10(15)5-3-4-8(13)11(14)16/h7-9H,3-6,13H2,1-2H3,(H,17,18) |
| InChIKey | TVHUWGZUAYCJHS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|