C12H21NO5 — CID 22845087
methyl 3-[(2S)-2-carbamoyloxy-3-hydroxypropyl]cyclohexane-1-carboxylate (PubChem CID 22845087) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is methyl 3-[(2S)-2-carbamoyloxy-3-hydroxypropyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 3-[(2S)-2-carbamoyloxy-3-hydroxypropyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 22845087 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | methyl 3-[(2S)-2-carbamoyloxy-3-hydroxypropyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCC(C[C@@H](CO)OC(N)=O)C1 |
| InChI | InChI=1S/C12H21NO5/c1-17-11(15)9-4-2-3-8(5-9)6-10(7-14)18-12(13)16/h8-10,14H,2-7H2,1H3,(H2,13,16)/t8?,9?,10-/m0/s1 |
| InChIKey | DWOYRENRIKOIKE-RTBKNWGFSA-N |
| XLogP | 0.81 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |