C9H17INO2- — CID 153277175
cis-methyl (1S,3R)-3-(aminoiodanuidylmethyl)cyclohexane-1-carboxylate (PubChem CID 153277175) has the molecular formula C9H17INO2- and a molecular weight of 298.14 g/mol. Its IUPAC name is cis-methyl (1S,3R)-3-(aminoiodanuidylmethyl)cyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1S,3R)-3-(aminoiodanuidylmethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 153277175 |
| Molecular Formula | C9H17INO2- |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | cis-methyl (1S,3R)-3-(aminoiodanuidylmethyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC[C@@H](C[I-]N)C1 |
| InChI | InChI=1S/C9H17INO2/c1-13-9(12)8-4-2-3-7(5-8)6-10-11/h7-8H,2-6,11H2,1H3/q-1/t7-,8+/m1/s1 |
| InChIKey | BVQSASCWIAPVLK-SFYZADRCSA-N |
| XLogP | -2.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|