C30H40O5 — CID 22845929
[2-(4-octoxyphenyl)phenyl] (2S,5S)-5-butyl-6-oxooxane-2-carboxylate (PubChem CID 22845929) has the molecular formula C30H40O5 and a molecular weight of 480.65 g/mol. Its IUPAC name is [2-(4-octoxyphenyl)phenyl] (2S,5S)-5-butyl-6-oxooxane-2-carboxylate.
| Compound Name | [2-(4-octoxyphenyl)phenyl] (2S,5S)-5-butyl-6-oxooxane-2-carboxylate |
|---|---|
| PubChem CID | 22845929 |
| Molecular Formula | C30H40O5 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | [2-(4-octoxyphenyl)phenyl] (2S,5S)-5-butyl-6-oxooxane-2-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ccccc2OC(=O)[C@@H]2CC[C@H](CCCC)C(=O)O2)cc1 |
| InChI | InChI=1S/C30H40O5/c1-3-5-7-8-9-12-22-33-25-19-16-23(17-20-25)26-14-10-11-15-27(26)34-30(32)28-21-18-24(13-6-4-2)29(31)35-28/h10-11,14-17,19-20,24,28H,3-9,12-13,18,21-22H2,1-2H3/t24-,28-/m0/s1 |
| InChIKey | YPTUGKRUZWRWLX-CUBQBAPOSA-N |
| XLogP | 7.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|