C30H40O5 — CID 54494758
(3S)-2,2-diethyl-5-[2-(4-octoxyphenyl)phenyl]-6-oxooxane-3-carboxylic acid (PubChem CID 54494758) has the molecular formula C30H40O5 and a molecular weight of 480.65 g/mol. Its IUPAC name is (3S)-2,2-diethyl-5-[2-(4-octoxyphenyl)phenyl]-6-oxooxane-3-carboxylic acid.
| Compound Name | (3S)-2,2-diethyl-5-[2-(4-octoxyphenyl)phenyl]-6-oxooxane-3-carboxylic acid |
|---|---|
| PubChem CID | 54494758 |
| Molecular Formula | C30H40O5 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (3S)-2,2-diethyl-5-[2-(4-octoxyphenyl)phenyl]-6-oxooxane-3-carboxylic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccccc2C2C[C@H](C(=O)O)C(CC)(CC)OC2=O)cc1 |
| InChI | InChI=1S/C30H40O5/c1-4-7-8-9-10-13-20-34-23-18-16-22(17-19-23)24-14-11-12-15-25(24)26-21-27(28(31)32)30(5-2,6-3)35-29(26)33/h11-12,14-19,26-27H,4-10,13,20-21H2,1-3H3,(H,31,32)/t26?,27-/m1/s1 |
| InChIKey | XYGQCWHGFWCXFZ-SSYAZFEXSA-N |
| XLogP | 7.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|