C10H11F5O2 — CID 22845980
(E)-3-[(2R,3R)-3-(4,4,5,5,5-pentafluoropentyl)oxiran-2-yl]prop-2-enal (PubChem CID 22845980) has the molecular formula C10H11F5O2 and a molecular weight of 258.19 g/mol. Its IUPAC name is (E)-3-[(2R,3R)-3-(4,4,5,5,5-pentafluoropentyl)oxiran-2-yl]prop-2-enal.
| Compound Name | (E)-3-[(2R,3R)-3-(4,4,5,5,5-pentafluoropentyl)oxiran-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 22845980 |
| Molecular Formula | C10H11F5O2 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (E)-3-[(2R,3R)-3-(4,4,5,5,5-pentafluoropentyl)oxiran-2-yl]prop-2-enal |
| SMILES | O=C/C=C/[C@H]1O[C@@H]1CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F5O2/c11-9(12,10(13,14)15)5-1-3-7-8(17-7)4-2-6-16/h2,4,6-8H,1,3,5H2/b4-2+/t7-,8-/m1/s1 |
| InChIKey | HMHHCWCUYKSZEU-WGAMGKKUSA-N |
| XLogP | 2.88 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|