C9H11FN2O4 — CID 22847474
(3R,4R,5R)-3-fluoro-2-pyrimidin-2-yloxane-3,4,5-triol (PubChem CID 22847474) has the molecular formula C9H11FN2O4 and a molecular weight of 230.20 g/mol. Its IUPAC name is (3R,4R,5R)-3-fluoro-2-pyrimidin-2-yloxane-3,4,5-triol.
| Compound Name | (3R,4R,5R)-3-fluoro-2-pyrimidin-2-yloxane-3,4,5-triol |
|---|---|
| PubChem CID | 22847474 |
| Molecular Formula | C9H11FN2O4 |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (3R,4R,5R)-3-fluoro-2-pyrimidin-2-yloxane-3,4,5-triol |
| SMILES | O[C@@H]1COC(c2ncccn2)[C@](O)(F)[C@@H]1O |
| InChI | InChI=1S/C9H11FN2O4/c10-9(15)6(14)5(13)4-16-7(9)8-11-2-1-3-12-8/h1-3,5-7,13-15H,4H2/t5-,6-,7?,9+/m1/s1 |
| InChIKey | MGIFHMUZNXDVSA-AGGUXCKUSA-N |
| XLogP | -1.07 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |