C11H12N2O6 — CID 22848336
(5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[(E)-2-nitroethenyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 22848336) has the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. Its IUPAC name is (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[(E)-2-nitroethenyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[(E)-2-nitroethenyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22848336 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[(E)-2-nitroethenyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(/C=C/[N+](=O)[O-])C[C@H]12 |
| InChI | InChI=1S/C11H12N2O6/c1-5(14)8-7-4-6(2-3-12(18)19)9(11(16)17)13(7)10(8)15/h2-3,5,7-8,14H,4H2,1H3,(H,16,17)/b3-2+/t5-,7-,8-/m1/s1 |
| InChIKey | GGIISFQOJUQMEY-BLXRUGCZSA-N |
| XLogP | -0.27 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|