C14H30O3Si — CID 22848916
tert-butyl-[(2S,3R,5R)-2-(methoxymethyl)-5-methyloxan-3-yl]oxy-dimethylsilane (PubChem CID 22848916) has the molecular formula C14H30O3Si and a molecular weight of 274.48 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,5R)-2-(methoxymethyl)-5-methyloxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R,5R)-2-(methoxymethyl)-5-methyloxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 22848916 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | tert-butyl-[(2S,3R,5R)-2-(methoxymethyl)-5-methyloxan-3-yl]oxy-dimethylsilane |
| SMILES | COC[C@@H]1OC[C@H](C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O3Si/c1-11-8-12(13(10-15-5)16-9-11)17-18(6,7)14(2,3)4/h11-13H,8-10H2,1-7H3/t11-,12-,13+/m1/s1 |
| InChIKey | KUFKHFSBLLNYJT-UPJWGTAASA-N |
| XLogP | 3.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|