C16H16N2O8S — CID 22850353
(6R,7R)-3-(1-acetyloxy-2,3,7-trioxocycloheptyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22850353) has the molecular formula C16H16N2O8S and a molecular weight of 396.38 g/mol. Its IUPAC name is (6R,7R)-3-(1-acetyloxy-2,3,7-trioxocycloheptyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-(1-acetyloxy-2,3,7-trioxocycloheptyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22850353 |
| Molecular Formula | C16H16N2O8S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (6R,7R)-3-(1-acetyloxy-2,3,7-trioxocycloheptyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OC1(C2=C(C(=O)O)N3C(=O)[C@@H](N)[C@H]3SC2)C(=O)CCCC(=O)C1=O |
| InChI | InChI=1S/C16H16N2O8S/c1-6(19)26-16(9(21)4-2-3-8(20)12(16)22)7-5-27-14-10(17)13(23)18(14)11(7)15(24)25/h10,14H,2-5,17H2,1H3,(H,24,25)/t10-,14-,16?/m1/s1 |
| InChIKey | RROHKFSIGWADQY-GGNQIRCASA-N |
| XLogP | -1.24 |
| TPSA | 161.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|