C23H30N2O3S — CID 22852988
(2S)-3-[(2S)-1-[4-(2,3-dihydro-1H-inden-2-yl)butanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbothioic S-acid (PubChem CID 22852988) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is (2S)-3-[(2S)-1-[4-(2,3-dihydro-1H-inden-2-yl)butanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbothioic S-acid.
| Compound Name | (2S)-3-[(2S)-1-[4-(2,3-dihydro-1H-inden-2-yl)butanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbothioic S-acid |
|---|---|
| PubChem CID | 22852988 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (2S)-3-[(2S)-1-[4-(2,3-dihydro-1H-inden-2-yl)butanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbothioic S-acid |
| SMILES | O=C(S)[C@H]1NCCC1C(=O)[C@@H]1CCCN1C(=O)CCCC1Cc2ccccc2C1 |
| InChI | InChI=1S/C23H30N2O3S/c26-20(9-3-5-15-13-16-6-1-2-7-17(16)14-15)25-12-4-8-19(25)22(27)18-10-11-24-21(18)23(28)29/h1-2,6-7,15,18-19,21,24H,3-5,8-14H2,(H,28,29)/t18?,19-,21-/m0/s1 |
| InChIKey | XVRQMXLAVCPFCC-ZDZADGERSA-N |
| XLogP | 2.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|