C22H28N2O3S — CID 22852978
(2S)-3-[(2S)-1-[3-(2,3-dihydro-1H-inden-2-yl)propanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbothioic S-acid (PubChem CID 22852978) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is (2S)-3-[(2S)-1-[3-(2,3-dihydro-1H-inden-2-yl)propanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbothioic S-acid.
| Compound Name | (2S)-3-[(2S)-1-[3-(2,3-dihydro-1H-inden-2-yl)propanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbothioic S-acid |
|---|---|
| PubChem CID | 22852978 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (2S)-3-[(2S)-1-[3-(2,3-dihydro-1H-inden-2-yl)propanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbothioic S-acid |
| SMILES | O=C(S)[C@H]1NCCC1C(=O)[C@@H]1CCCN1C(=O)CCC1Cc2ccccc2C1 |
| InChI | InChI=1S/C22H28N2O3S/c25-19(8-7-14-12-15-4-1-2-5-16(15)13-14)24-11-3-6-18(24)21(26)17-9-10-23-20(17)22(27)28/h1-2,4-5,14,17-18,20,23H,3,6-13H2,(H,27,28)/t17?,18-,20-/m0/s1 |
| InChIKey | MKWSRIVMKCRDGL-WSTRIDTPSA-N |
| XLogP | 2.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|