C32H29N5O7 — CID 22854072
(3S)-3-[bis[2-(4-nitrophenoxy)ethyl]amino]-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 22854072) has the molecular formula C32H29N5O7 and a molecular weight of 595.61 g/mol. Its IUPAC name is (3S)-3-[bis[2-(4-nitrophenoxy)ethyl]amino]-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-3-[bis[2-(4-nitrophenoxy)ethyl]amino]-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 22854072 |
| Molecular Formula | C32H29N5O7 |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | (3S)-3-[bis[2-(4-nitrophenoxy)ethyl]amino]-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)[C@@H](N(CCOc2ccc([N+](=O)[O-])cc2)CCOc2ccc([N+](=O)[O-])cc2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C32H29N5O7/c1-34-29-10-6-5-9-28(29)30(23-7-3-2-4-8-23)33-31(32(34)38)35(19-21-43-26-15-11-24(12-16-26)36(39)40)20-22-44-27-17-13-25(14-18-27)37(41)42/h2-18,31H,19-22H2,1H3/t31-/m1/s1 |
| InChIKey | UBAGAHGJCRXEAR-WJOKGBTCSA-N |
| XLogP | 5.10 |
| TPSA | 140.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|