C27H25N5O6 — CID 22984528
(2S)-N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2-[[2-(4-nitrophenoxy)acetyl]amino]propanamide (PubChem CID 22984528) has the molecular formula C27H25N5O6 and a molecular weight of 515.53 g/mol. Its IUPAC name is (2S)-N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2-[[2-(4-nitrophenoxy)acetyl]amino]propanamide.
| Compound Name | (2S)-N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2-[[2-(4-nitrophenoxy)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 22984528 |
| Molecular Formula | C27H25N5O6 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | (2S)-N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2-[[2-(4-nitrophenoxy)acetyl]amino]propanamide |
| SMILES | C[C@H](NC(=O)COc1ccc([N+](=O)[O-])cc1)C(=O)N[C@H]1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C27H25N5O6/c1-17(28-23(33)16-38-20-14-12-19(13-15-20)32(36)37)26(34)30-25-27(35)31(2)22-11-7-6-10-21(22)24(29-25)18-8-4-3-5-9-18/h3-15,17,25H,16H2,1-2H3,(H,28,33)(H,30,34)/t17-,25+/m0/s1 |
| InChIKey | MKZBOVNDBDUJPA-SSOJOUAXSA-N |
| XLogP | 2.43 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|