C26H24N6O5 — CID 70143399
(2S)-N-[(3S)-1-methyl-2-oxo-5-pyridin-2-yl-3H-1,4-benzodiazepin-3-yl]-2-[[2-(3-nitrophenyl)acetyl]amino]propanamide (PubChem CID 70143399) has the molecular formula C26H24N6O5 and a molecular weight of 500.52 g/mol. Its IUPAC name is (2S)-N-[(3S)-1-methyl-2-oxo-5-pyridin-2-yl-3H-1,4-benzodiazepin-3-yl]-2-[[2-(3-nitrophenyl)acetyl]amino]propanamide.
| Compound Name | (2S)-N-[(3S)-1-methyl-2-oxo-5-pyridin-2-yl-3H-1,4-benzodiazepin-3-yl]-2-[[2-(3-nitrophenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 70143399 |
| Molecular Formula | C26H24N6O5 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | (2S)-N-[(3S)-1-methyl-2-oxo-5-pyridin-2-yl-3H-1,4-benzodiazepin-3-yl]-2-[[2-(3-nitrophenyl)acetyl]amino]propanamide |
| SMILES | C[C@H](NC(=O)Cc1cccc([N+](=O)[O-])c1)C(=O)N[C@H]1N=C(c2ccccn2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C26H24N6O5/c1-16(28-22(33)15-17-8-7-9-18(14-17)32(36)37)25(34)30-24-26(35)31(2)21-12-4-3-10-19(21)23(29-24)20-11-5-6-13-27-20/h3-14,16,24H,15H2,1-2H3,(H,28,33)(H,30,34)/t16-,24+/m0/s1 |
| InChIKey | ADZPQUHVPSTHLQ-UPCLLVRISA-N |
| XLogP | 1.99 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|