C21H25BrN2O6 — CID 22855709
5-[(E)-2-bromoethenyl]-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-[(4-propan-2-ylphenyl)methoxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 22855709) has the molecular formula C21H25BrN2O6 and a molecular weight of 481.34 g/mol. Its IUPAC name is 5-[(E)-2-bromoethenyl]-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-[(4-propan-2-ylphenyl)methoxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-2-bromoethenyl]-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-[(4-propan-2-ylphenyl)methoxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22855709 |
| Molecular Formula | C21H25BrN2O6 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 5-[(E)-2-bromoethenyl]-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-[(4-propan-2-ylphenyl)methoxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)c1ccc(COC[C@H]2O[C@@H](n3cc(/C=C/Br)c(=O)[nH]c3=O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C21H25BrN2O6/c1-12(2)14-5-3-13(4-6-14)10-29-11-16-17(25)18(26)20(30-16)24-9-15(7-8-22)19(27)23-21(24)28/h3-9,12,16-18,20,25-26H,10-11H2,1-2H3,(H,23,27,28)/b8-7+/t16-,17-,18+,20-/m1/s1 |
| InChIKey | AQLOGPBXSLDDMO-UEFJPRQNSA-N |
| XLogP | 1.86 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |