C12H14BrClN2O8S — CID 118413055
[(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-chlorooxy-4-hydroxyoxolan-2-yl]methyl methanesulfonate (PubChem CID 118413055) has the molecular formula C12H14BrClN2O8S and a molecular weight of 461.67 g/mol. Its IUPAC name is [(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-chlorooxy-4-hydroxyoxolan-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-chlorooxy-4-hydroxyoxolan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 118413055 |
| Molecular Formula | C12H14BrClN2O8S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 459.93 |
| IUPAC Name | [(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-chlorooxy-4-hydroxyoxolan-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1O[C@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)C(O)C1OCl |
| InChI | InChI=1S/C12H14BrClN2O8S/c1-25(20,21)22-5-7-9(24-14)8(17)11(23-7)16-4-6(2-3-13)10(18)15-12(16)19/h2-4,7-9,11,17H,5H2,1H3,(H,15,18,19)/b3-2+/t7-,8?,9?,11-/m0/s1 |
| InChIKey | DFIOPOTUEZPWAH-OSJCJLCNSA-N |
| XLogP | -0.32 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|