C22H29N3O5 — CID 22860935
(2S)-2-acetamido-N-[(2S)-1-(2,6-dioxopiperidin-3-yl)-1-oxo-3-phenylpropan-2-yl]-4-methylpentanamide (PubChem CID 22860935) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(2S)-1-(2,6-dioxopiperidin-3-yl)-1-oxo-3-phenylpropan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-acetamido-N-[(2S)-1-(2,6-dioxopiperidin-3-yl)-1-oxo-3-phenylpropan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 22860935 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (2S)-2-acetamido-N-[(2S)-1-(2,6-dioxopiperidin-3-yl)-1-oxo-3-phenylpropan-2-yl]-4-methylpentanamide |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C22H29N3O5/c1-13(2)11-18(23-14(3)26)22(30)24-17(12-15-7-5-4-6-8-15)20(28)16-9-10-19(27)25-21(16)29/h4-8,13,16-18H,9-12H2,1-3H3,(H,23,26)(H,24,30)(H,25,27,29)/t16?,17-,18-/m0/s1 |
| InChIKey | CKVFJKLJZBPRCT-FQECFTEESA-N |
| XLogP | 0.89 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|