C25H25ClF7NO4S — CID 22866197
2-[(3S)-3-[3,4-bis(trifluoromethyl)phenyl]-1-[2-(2-chloro-6-fluorophenyl)acetyl]azepan-3-yl]ethyl methanesulfonate (PubChem CID 22866197) has the molecular formula C25H25ClF7NO4S and a molecular weight of 603.98 g/mol. Its IUPAC name is 2-[(3S)-3-[3,4-bis(trifluoromethyl)phenyl]-1-[2-(2-chloro-6-fluorophenyl)acetyl]azepan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(3S)-3-[3,4-bis(trifluoromethyl)phenyl]-1-[2-(2-chloro-6-fluorophenyl)acetyl]azepan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22866197 |
| Molecular Formula | C25H25ClF7NO4S |
| Molecular Weight | 603.98 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | 2-[(3S)-3-[3,4-bis(trifluoromethyl)phenyl]-1-[2-(2-chloro-6-fluorophenyl)acetyl]azepan-3-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC[C@]1(c2ccc(C(F)(F)F)c(C(F)(F)F)c2)CCCCN(C(=O)Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C25H25ClF7NO4S/c1-39(36,37)38-12-10-23(16-7-8-18(24(28,29)30)19(13-16)25(31,32)33)9-2-3-11-34(15-23)22(35)14-17-20(26)5-4-6-21(17)27/h4-8,13H,2-3,9-12,14-15H2,1H3/t23-/m1/s1 |
| InChIKey | NBULIWXSCYQSCR-HSZRJFAPSA-N |
| XLogP | 6.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.98 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|