C15H21ClN2O3 — CID 2286765
2-chloro-N-[(2S)-2-ethylhexyl]-4-nitrobenzamide (PubChem CID 2286765) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-2-ethylhexyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[(2S)-2-ethylhexyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 2286765 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-chloro-N-[(2S)-2-ethylhexyl]-4-nitrobenzamide |
| SMILES | CCCC[C@H](CC)CNC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H21ClN2O3/c1-3-5-6-11(4-2)10-17-15(19)13-8-7-12(18(20)21)9-14(13)16/h7-9,11H,3-6,10H2,1-2H3,(H,17,19)/t11-/m0/s1 |
| InChIKey | QLGCSVQNOOUWQB-NSHDSACASA-N |
| XLogP | 4.19 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|