C19H26ClNO2 — CID 22868
(4-carboxy-4-naphthalen-1-ylhexyl)-dimethylazanium chloride (PubChem CID 22868) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is (4-carboxy-4-naphthalen-1-ylhexyl)-dimethylazanium chloride.
| Compound Name | (4-carboxy-4-naphthalen-1-ylhexyl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 22868 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (4-carboxy-4-naphthalen-1-ylhexyl)-dimethylazanium chloride |
| SMILES | CCC(CCC[NH+](C)C)(C(=O)O)c1cccc2ccccc12.[Cl-] |
| InChI | InChI=1S/C19H25NO2.ClH/c1-4-19(18(21)22,13-8-14-20(2)3)17-12-7-10-15-9-5-6-11-16(15)17;/h5-7,9-12H,4,8,13-14H2,1-3H3,(H,21,22);1H |
| InChIKey | DJIAPFIMPIWYNG-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |