C15H26N2O6 — CID 22869541
tert-butyl (2S)-2-[(2R)-4-ethoxy-1-nitro-4-oxobutan-2-yl]pyrrolidine-1-carboxylate (PubChem CID 22869541) has the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-4-ethoxy-1-nitro-4-oxobutan-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2R)-4-ethoxy-1-nitro-4-oxobutan-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22869541 |
| Molecular Formula | C15H26N2O6 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-4-ethoxy-1-nitro-4-oxobutan-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C[C@H](C[N+](=O)[O-])[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N2O6/c1-5-22-13(18)9-11(10-17(20)21)12-7-6-8-16(12)14(19)23-15(2,3)4/h11-12H,5-10H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | NIEZOFRMGJDAGG-NEPJUHHUSA-N |
| XLogP | 2.23 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|