C22H31ClO4 — CID 22869894
[(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-9-chloro-10,13-dimethyl-3-oxo-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] formate (PubChem CID 22869894) has the molecular formula C22H31ClO4 and a molecular weight of 394.94 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-9-chloro-10,13-dimethyl-3-oxo-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] formate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-9-chloro-10,13-dimethyl-3-oxo-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] formate |
|---|---|
| PubChem CID | 22869894 |
| Molecular Formula | C22H31ClO4 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,17S)-17-acetyl-9-chloro-10,13-dimethyl-3-oxo-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] formate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4CC(=O)CC[C@]4(C)[C@@]3(Cl)[C@@H](OC=O)C[C@]12C |
| InChI | InChI=1S/C22H31ClO4/c1-13(25)16-6-7-17-18-5-4-14-10-15(26)8-9-21(14,3)22(18,23)19(27-12-24)11-20(16,17)2/h12,14,16-19H,4-11H2,1-3H3/t14?,16-,17+,18+,19+,20-,21+,22+/m1/s1 |
| InChIKey | QSAQJPDXIPEWHH-XQMIOSBJSA-N |
| XLogP | 4.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|