C28H31N3O4 — CID 22870553
(2S)-2-[[(3S)-5-[[4-(dimethylamino)phenyl]methyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-4-phenylbutanoic acid (PubChem CID 22870553) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is (2S)-2-[[(3S)-5-[[4-(dimethylamino)phenyl]methyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-4-phenylbutanoic acid.
| Compound Name | (2S)-2-[[(3S)-5-[[4-(dimethylamino)phenyl]methyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 22870553 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (2S)-2-[[(3S)-5-[[4-(dimethylamino)phenyl]methyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-4-phenylbutanoic acid |
| SMILES | CN(C)c1ccc(CN2C(=O)[C@@H](N[C@@H](CCc3ccccc3)C(=O)O)COc3ccccc32)cc1 |
| InChI | InChI=1S/C28H31N3O4/c1-30(2)22-15-12-21(13-16-22)18-31-25-10-6-7-11-26(25)35-19-24(27(31)32)29-23(28(33)34)17-14-20-8-4-3-5-9-20/h3-13,15-16,23-24,29H,14,17-19H2,1-2H3,(H,33,34)/t23-,24-/m0/s1 |
| InChIKey | IFRIDVSBVKNNPW-ZEQRLZLVSA-N |
| XLogP | 3.72 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|