C26H27N3O4 — CID 67713999
(2S)-2-[[5-[(4-aminophenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-4-phenylbutanoic acid (PubChem CID 67713999) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (2S)-2-[[5-[(4-aminophenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-4-phenylbutanoic acid.
| Compound Name | (2S)-2-[[5-[(4-aminophenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 67713999 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (2S)-2-[[5-[(4-aminophenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-4-phenylbutanoic acid |
| SMILES | Nc1ccc(CN2C(=O)C(N[C@@H](CCc3ccccc3)C(=O)O)COc3ccccc32)cc1 |
| InChI | InChI=1S/C26H27N3O4/c27-20-13-10-19(11-14-20)16-29-23-8-4-5-9-24(23)33-17-22(25(29)30)28-21(26(31)32)15-12-18-6-2-1-3-7-18/h1-11,13-14,21-22,28H,12,15-17,27H2,(H,31,32)/t21-,22?/m0/s1 |
| InChIKey | RFNVIZSIGMHHKE-HMTLIYDFSA-N |
| XLogP | 3.24 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|