C27H30N4O2 — CID 67716816
(2S)-2-[[1-[(4-aminophenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-4-phenylbutanamide (PubChem CID 67716816) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is (2S)-2-[[1-[(4-aminophenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-4-phenylbutanamide.
| Compound Name | (2S)-2-[[1-[(4-aminophenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-4-phenylbutanamide |
|---|---|
| PubChem CID | 67716816 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (2S)-2-[[1-[(4-aminophenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-4-phenylbutanamide |
| SMILES | NC(=O)[C@H](CCc1ccccc1)NC1CCc2ccccc2N(Cc2ccc(N)cc2)C1=O |
| InChI | InChI=1S/C27H30N4O2/c28-22-14-10-20(11-15-22)18-31-25-9-5-4-8-21(25)13-17-24(27(31)33)30-23(26(29)32)16-12-19-6-2-1-3-7-19/h1-11,14-15,23-24,30H,12-13,16-18,28H2,(H2,29,32)/t23-,24?/m0/s1 |
| InChIKey | OAQOZPSHDBEILT-UXMRNZNESA-N |
| XLogP | 3.19 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|