C28H31N3O4 — CID 22878802
(2S)-N-hydroxy-2-[[(3S)-1-[(4-methoxyphenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-4-phenylbutanamide (PubChem CID 22878802) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is (2S)-N-hydroxy-2-[[(3S)-1-[(4-methoxyphenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-4-phenylbutanamide.
| Compound Name | (2S)-N-hydroxy-2-[[(3S)-1-[(4-methoxyphenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-4-phenylbutanamide |
|---|---|
| PubChem CID | 22878802 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (2S)-N-hydroxy-2-[[(3S)-1-[(4-methoxyphenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-4-phenylbutanamide |
| SMILES | COc1ccc(CN2C(=O)[C@@H](N[C@@H](CCc3ccccc3)C(=O)NO)CCc3ccccc32)cc1 |
| InChI | InChI=1S/C28H31N3O4/c1-35-23-15-11-21(12-16-23)19-31-26-10-6-5-9-22(26)14-18-25(28(31)33)29-24(27(32)30-34)17-13-20-7-3-2-4-8-20/h2-12,15-16,24-25,29,34H,13-14,17-19H2,1H3,(H,30,32)/t24-,25-/m0/s1 |
| InChIKey | BXTZPLQUUGYULW-DQEYMECFSA-N |
| XLogP | 3.64 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|