C26H28N4O2 — CID 67716960
(2S)-2-[[1-[(4-aminophenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-3-phenylpropanamide (PubChem CID 67716960) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is (2S)-2-[[1-[(4-aminophenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[1-[(4-aminophenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 67716960 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (2S)-2-[[1-[(4-aminophenyl)methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]-3-phenylpropanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC1CCc2ccccc2N(Cc2ccc(N)cc2)C1=O |
| InChI | InChI=1S/C26H28N4O2/c27-21-13-10-19(11-14-21)17-30-24-9-5-4-8-20(24)12-15-22(26(30)32)29-23(25(28)31)16-18-6-2-1-3-7-18/h1-11,13-14,22-23,29H,12,15-17,27H2,(H2,28,31)/t22?,23-/m0/s1 |
| InChIKey | WQWPESUENKDFBF-WCSIJFPASA-N |
| XLogP | 2.80 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|