C9H13N3O — CID 22871178
N'-(3-hydroxy-2-pyridinyl)butanimidamide (PubChem CID 22871178) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is N'-(3-hydroxy-2-pyridinyl)butanimidamide.
| Compound Name | N'-(3-hydroxy-2-pyridinyl)butanimidamide |
|---|---|
| PubChem CID | 22871178 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N'-(3-hydroxy-2-pyridinyl)butanimidamide |
| SMILES | CCC/C(N)=N\c1ncccc1O |
| InChI | InChI=1S/C9H13N3O/c1-2-4-8(10)12-9-7(13)5-3-6-11-9/h3,5-6,13H,2,4H2,1H3,(H2,10,11,12) |
| InChIKey | WCMJUSWSSNVYED-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|