C12H18N2 — CID 63178290
N'-(2-ethylphenyl)butanimidamide (PubChem CID 63178290) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N'-(2-ethylphenyl)butanimidamide.
| Compound Name | N'-(2-ethylphenyl)butanimidamide |
|---|---|
| PubChem CID | 63178290 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N'-(2-ethylphenyl)butanimidamide |
| SMILES | CCC/C(N)=N\c1ccccc1CC |
| InChI | InChI=1S/C12H18N2/c1-3-7-12(13)14-11-9-6-5-8-10(11)4-2/h5-6,8-9H,3-4,7H2,1-2H3,(H2,13,14) |
| InChIKey | HQGHRWFWEQFBAZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|