C10H9F3IN — CID 14930845
N-(2-ethylphenyl)-2,2,2-trifluoroethanimidoyl iodide (PubChem CID 14930845) has the molecular formula C10H9F3IN and a molecular weight of 327.09 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2,2,2-trifluoroethanimidoyl iodide.
| Compound Name | N-(2-ethylphenyl)-2,2,2-trifluoroethanimidoyl iodide |
|---|---|
| PubChem CID | 14930845 |
| Molecular Formula | C10H9F3IN |
| Molecular Weight | 327.09 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | N-(2-ethylphenyl)-2,2,2-trifluoroethanimidoyl iodide |
| SMILES | CCc1ccccc1/N=C(\I)C(F)(F)F |
| InChI | InChI=1S/C10H9F3IN/c1-2-7-5-3-4-6-8(7)15-9(14)10(11,12)13/h3-6H,2H2,1H3/b15-9- |
| InChIKey | CMAKQHKPCUXWNE-DHDCSXOGSA-N |
| XLogP | 4.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.09 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|