C13H13NO4-2 — CID 8008003
2-(2-ethylphenyl)iminopentanedioate (PubChem CID 8008003) has the molecular formula C13H13NO4-2 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-(2-ethylphenyl)iminopentanedioate.
| Compound Name | 2-(2-ethylphenyl)iminopentanedioate |
|---|---|
| PubChem CID | 8008003 |
| Molecular Formula | C13H13NO4-2 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-(2-ethylphenyl)iminopentanedioate |
| SMILES | CCc1ccccc1/N=C(\CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C13H15NO4/c1-2-9-5-3-4-6-10(9)14-11(13(17)18)7-8-12(15)16/h3-6H,2,7-8H2,1H3,(H,15,16)(H,17,18)/p-2/b14-11+ |
| InChIKey | NNOIFBLMBMOEKF-SDNWHVSQSA-L |
| XLogP | -0.40 |
| TPSA | 92.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|