C21H25ClN2 — CID 87163235
5-chloro-2-N,3-N-bis(2-ethylphenyl)pentane-2,3-diimine (PubChem CID 87163235) has the molecular formula C21H25ClN2 and a molecular weight of 340.90 g/mol. Its IUPAC name is 5-chloro-2-N,3-N-bis(2-ethylphenyl)pentane-2,3-diimine.
| Compound Name | 5-chloro-2-N,3-N-bis(2-ethylphenyl)pentane-2,3-diimine |
|---|---|
| PubChem CID | 87163235 |
| Molecular Formula | C21H25ClN2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 5-chloro-2-N,3-N-bis(2-ethylphenyl)pentane-2,3-diimine |
| SMILES | CCc1ccccc1/N=C(C)/C(CCCl)=N/c1ccccc1CC |
| InChI | InChI=1S/C21H25ClN2/c1-4-17-10-6-8-12-20(17)23-16(3)19(14-15-22)24-21-13-9-7-11-18(21)5-2/h6-13H,4-5,14-15H2,1-3H3/b23-16+,24-19+ |
| InChIKey | OQZDXFWMAVPHQT-FXSINEHXSA-N |
| XLogP | 6.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|