C14H19Cl2FeNO — CID 154027027
dichloroiron;3-(2,6-diethylphenyl)iminobutan-2-one (PubChem CID 154027027) has the molecular formula C14H19Cl2FeNO and a molecular weight of 344.06 g/mol. Its IUPAC name is dichloroiron;3-(2,6-diethylphenyl)iminobutan-2-one.
| Compound Name | dichloroiron;3-(2,6-diethylphenyl)iminobutan-2-one |
|---|---|
| PubChem CID | 154027027 |
| Molecular Formula | C14H19Cl2FeNO |
| Molecular Weight | 344.06 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | dichloroiron;3-(2,6-diethylphenyl)iminobutan-2-one |
| SMILES | CCc1cccc(CC)c1/N=C(\C)C(C)=O.Cl[Fe]Cl |
| InChI | InChI=1S/C14H19NO.2ClH.Fe/c1-5-12-8-7-9-13(6-2)14(12)15-10(3)11(4)16;;;/h7-9H,5-6H2,1-4H3;2*1H;/q;;;+2/p-2/b15-10+;;; |
| InChIKey | GPXNOBBYXRZFKQ-RJQKUYQSSA-L |
| XLogP | 4.87 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.06 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|