C9H6BrClF3N — CID 53437556
N-[2-(bromomethyl)phenyl]-2,2,2-trifluoroethanimidoyl chloride (PubChem CID 53437556) has the molecular formula C9H6BrClF3N and a molecular weight of 300.50 g/mol. Its IUPAC name is N-[2-(bromomethyl)phenyl]-2,2,2-trifluoroethanimidoyl chloride.
| Compound Name | N-[2-(bromomethyl)phenyl]-2,2,2-trifluoroethanimidoyl chloride |
|---|---|
| PubChem CID | 53437556 |
| Molecular Formula | C9H6BrClF3N |
| Molecular Weight | 300.50 g/mol |
| Exact Mass | 298.93 |
| IUPAC Name | N-[2-(bromomethyl)phenyl]-2,2,2-trifluoroethanimidoyl chloride |
| SMILES | FC(F)(F)/C(Cl)=N/c1ccccc1CBr |
| InChI | InChI=1S/C9H6BrClF3N/c10-5-6-3-1-2-4-7(6)15-8(11)9(12,13)14/h1-4H,5H2/b15-8- |
| InChIKey | HYYXUJRCTJXVAW-NVNXTCNLSA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|