C14H13ClF3N — CID 11833047
2,2,2-trifluoro-N-(2-hex-1-ynylphenyl)ethanimidoyl chloride (PubChem CID 11833047) has the molecular formula C14H13ClF3N and a molecular weight of 287.71 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-hex-1-ynylphenyl)ethanimidoyl chloride.
| Compound Name | 2,2,2-trifluoro-N-(2-hex-1-ynylphenyl)ethanimidoyl chloride |
|---|---|
| PubChem CID | 11833047 |
| Molecular Formula | C14H13ClF3N |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-hex-1-ynylphenyl)ethanimidoyl chloride |
| SMILES | CCCCC#Cc1ccccc1/N=C(\Cl)C(F)(F)F |
| InChI | InChI=1S/C14H13ClF3N/c1-2-3-4-5-8-11-9-6-7-10-12(11)19-13(15)14(16,17)18/h6-7,9-10H,2-4H2,1H3/b19-13- |
| InChIKey | KMIKEQVJGHIKCR-UYRXBGFRSA-N |
| XLogP | 5.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|