C10H11BrCl2N2 — CID 107794166
N'-(4-bromo-2,3-dichlorophenyl)butanimidamide (PubChem CID 107794166) has the molecular formula C10H11BrCl2N2 and a molecular weight of 310.02 g/mol. Its IUPAC name is N'-(4-bromo-2,3-dichlorophenyl)butanimidamide.
| Compound Name | N'-(4-bromo-2,3-dichlorophenyl)butanimidamide |
|---|---|
| PubChem CID | 107794166 |
| Molecular Formula | C10H11BrCl2N2 |
| Molecular Weight | 310.02 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | N'-(4-bromo-2,3-dichlorophenyl)butanimidamide |
| SMILES | CCC/C(N)=N\c1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C10H11BrCl2N2/c1-2-3-8(14)15-7-5-4-6(11)9(12)10(7)13/h4-5H,2-3H2,1H3,(H2,14,15) |
| InChIKey | ZQWGQHCXIRHNCM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.02 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|