C21H18N2O6 — CID 2288324
ethyl 4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 2288324) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is ethyl 4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | ethyl 4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 2288324 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | ethyl 4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)NC(=O)/C(=C/c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H18N2O6/c1-3-29-20(26)14-6-8-15(9-7-14)23-19(25)17(18(24)22-21(23)27)12-13-4-10-16(28-2)11-5-13/h4-12H,3H2,1-2H3,(H,22,24,27)/b17-12- |
| InChIKey | FGVITPHVHAVZED-ATVHPVEESA-N |
| XLogP | 2.54 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|