C15H20ClNO — CID 22883510
(2S)-2-chloro-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)propanamide (PubChem CID 22883510) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is (2S)-2-chloro-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)propanamide.
| Compound Name | (2S)-2-chloro-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)propanamide |
|---|---|
| PubChem CID | 22883510 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (2S)-2-chloro-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)propanamide |
| SMILES | CC1CC(C)(C)c2cccc(NC(=O)[C@H](C)Cl)c21 |
| InChI | InChI=1S/C15H20ClNO/c1-9-8-15(3,4)11-6-5-7-12(13(9)11)17-14(18)10(2)16/h5-7,9-10H,8H2,1-4H3,(H,17,18)/t9?,10-/m0/s1 |
| InChIKey | HZMKDHDBXOTRBI-AXDSSHIGSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|