C15H20N2O2S — CID 5391373
(3S)-1,1,3-trimethyl-N-[(Z)-1-methylsulfanyl-2-nitroethenyl]-2,3-dihydroinden-4-amine (PubChem CID 5391373) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is (3S)-1,1,3-trimethyl-N-[(Z)-1-methylsulfanyl-2-nitroethenyl]-2,3-dihydroinden-4-amine.
| Compound Name | (3S)-1,1,3-trimethyl-N-[(Z)-1-methylsulfanyl-2-nitroethenyl]-2,3-dihydroinden-4-amine |
|---|---|
| PubChem CID | 5391373 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (3S)-1,1,3-trimethyl-N-[(Z)-1-methylsulfanyl-2-nitroethenyl]-2,3-dihydroinden-4-amine |
| SMILES | CS/C(=C\[N+](=O)[O-])Nc1cccc2c1[C@@H](C)CC2(C)C |
| InChI | InChI=1S/C15H20N2O2S/c1-10-8-15(2,3)11-6-5-7-12(14(10)11)16-13(20-4)9-17(18)19/h5-7,9-10,16H,8H2,1-4H3/b13-9-/t10-/m0/s1 |
| InChIKey | LMVJJGSHPBUEIV-AVMBBCFPSA-N |
| XLogP | 4.32 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|